| id | C00004772 |
|---|---|
| Name | Myricetin 3,3',4'-trimethyl ether |
| CAS RN | 80368-72-5 |
| Standard InChI | InChI=1S/C18H16O8/c1-23-13-5-8(4-11(21)17(13)24-2)16-18(25-3)15(22)14-10(20)6-9(19)7-12(14)26-16/h4-7,19-21H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O8/c1-23-13-5-8(4-11(21)17(13)24-2)16-18(25-3)15(22)14-10(20)6-9(19)7-12(14)26-16/h4-7,19-21H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL1689269 |
|---|---|
| By standard InChI Main Layer | CHEMBL1689269 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Asteraceae | 1 |
| Cistaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cistus monspeliensis | 335184 | Cistaceae | rosids | Viridiplantae |
| Haplopappus integerrimus | 71051 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O14763 | Tumor necrosis factor receptor superfamily member 10B | Unclassified protein | CHEMBL1689269 |
CHEMBL1693927
(1)
|
1 / 0 |