| id | C00047872 | 
|---|---|
| Name | Excelside A | 
| CAS RN | 1149762-75-3 | 
| Standard InChI | InChI=1S/C24H36O16/c1-4-9-10(5-14(26)34-2)11(21(33)35-3)7-36-22(9)40-24-20(32)18(30)16(28)13(39-24)8-37-23-19(31)17(29)15(27)12(6-25)38-23/h4,7,10,12-13,15-20,22-25,27-32H,5-6,8H2,1-3H3/b9-4+/t10-,12+,13+,15+,16+,17-,18-,19+,20+,22-,23+,24-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C24H36O16/c1-4-9-10(5-14(26)34-2)11(21(33)35-3)7-36-22(9)40-24-20(32)18(30)16(28)13(39-24)8-37-23-19(31)17(29)15(27)12(6-25)38-23/h4,7,10,12-13,15-20,22-25,27-32H,5-6,8H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 545 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1086876 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Fraxinus excelsior | 38873 | Oleaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P14672 | Solute carrier family 2, facilitated glucose transporter member 4 | Unclassified protein | CHEMBL1086876 | CHEMBL1103148
                        (1) | 1 / 0 |