| id | C00047955 |
|---|---|
| Name | Lamiridosin A |
| CAS RN | 52571-98-9 |
| Standard InChI | InChI=1S/C11H16O7/c1-11(16)6-5(7(12)8(11)13)4(9(14)17-2)3-18-10(6)15/h3,5-8,10,12-13,15-16H,1-2H3/t5-,6-,7+,8+,10-,11-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H16O7/c1-11(16)6-5(7(12)8(11)13)4(9(14)17-2)3-18-10(6)15/h3,5-8,10,12-13,15-16H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3152 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1076150 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lamium album | 53159 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P60033 | CD81 antigen | Unclassified protein | CHEMBL1076150 |
CHEMBL1099753
(1)
|
1 / 1 |