id | C00048479 |
---|---|
Name | Methyl acetate |
CAS RN | 79-20-9 |
Standard InChI | InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5851 |
By standard InChI | CHEMBL14079 |
---|---|
By standard InChI Main Layer | CHEMBL14079 |
By LinkDB | C17530 |
---|
By CAS RN | C046923 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Citrus aurantifolia | 159033 | Rutaceae | rosids | Viridiplantae |
Citrus hystrix | 170989 | Rutaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL14079 |
CHEMBL1614458
(1)
|
0 / 0 |