| id | C00048633 | 
|---|---|
| Name | Bitungolide F | 
| CAS RN | 478694-59-6 | 
| Standard InChI | InChI=1S/C24H32O4/c1-3-20-14-16-23(27)28-24(20)18(2)13-15-22(26)17-21(25)12-8-7-11-19-9-5-4-6-10-19/h4-12,14,16,18,20-22,24-26H,3,13,15,17H2,1-2H3/b11-7+,12-8+/t18-,20-,21-,22-,24-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C24H32O4/c1-3-20-14-16-23(27)28-24(20)18(2)13-15-22(26)17-21(25)12-8-7-11-19-9-5-4-6-10-19/h4-12,14,16,18,20-22,24-26H,3,13,15,17H2,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1591 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL487749 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Theonellidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Theonella swinhoei | 37505 | Theonellidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P51452 | Dual specificity protein phosphatase 3 | Ser_Thr_Tyr | CHEMBL487749 | 
                        CHEMBL1034380
                        (1)
                         | 
                      0 / 0 |