| id | C00048714 |
|---|---|
| Name | Furospongolide |
| CAS RN | 76343-80-1 |
| Standard InChI | InChI=1S/C21H28O3/c1-17(8-4-10-19-12-13-23-15-19)6-3-7-18(2)9-5-11-20-14-21(22)24-16-20/h7-8,12-15H,3-6,9-11,16H2,1-2H3/b17-8+,18-7+ |
| Standard InChI (Main Layer) | InChI=1S/C21H28O3/c1-17(8-4-10-19-12-13-23-15-19)6-3-7-18(2)9-5-11-20-14-21(22)24-16-20/h7-8,12-15H,3-6,9-11,16H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4799 |
| By standard InChI | CHEMBL1077108 |
|---|---|
| By standard InChI Main Layer | CHEMBL1077108 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dysidea herbacea |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL1077108 |
CHEMBL1104948
(1)
CHEMBL1105812
(1)
CHEMBL1108467 (1) |
0 / 0 |
| P27540 | Aryl hydrocarbon receptor nuclear translocator | Unclassified protein | CHEMBL1077108 |
CHEMBL1105811
(1)
|
0 / 0 |