| id | C00049053 |
|---|---|
| Name | (-)-Jasmonic acid |
| CAS RN | 6894-38-8 |
| Standard InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15) |
| Phytochemical cluster | No. 70 |
|---|---|
| KCF-S cluster | No. 707 |
| By standard InChI | CHEMBL449572 |
|---|---|
| By standard InChI Main Layer | CHEMBL445499 CHEMBL449572 |
| By LinkDB | C08491 |
|---|
| By CAS RN | C011006 |
|---|
| family name | count |
|---|---|
| Fabaceae | 1 |
| Solanaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Petunia hybrida | 4102 | Solanaceae | asterids | Viridiplantae |
| Vicia faba L. | 3906 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17516 | Aldo-keto reductase family 1 member C4 | Enzyme | CHEMBL449572 |
CHEMBL2175100
(1)
|
1 / 0 |
| P42330 | Aldo-keto reductase family 1 member C3 | Enzyme | CHEMBL449572 |
CHEMBL2175101
(1)
|
0 / 0 |
| Q04828 | Aldo-keto reductase family 1 member C1 | Enzyme | CHEMBL449572 |
CHEMBL2175103
(1)
|
0 / 0 |
| P52895 | Aldo-keto reductase family 1 member C2 | Enzyme | CHEMBL449572 |
CHEMBL2175102
(1)
|
1 / 0 |