| id | C00049398 |
|---|---|
| Name | Sideroxylonal C |
| CAS RN | 222411-74-7 |
| Standard InChI | InChI=1S/C26H28O10/c1-10(2)5-12-17(11(3)4)26(19-23(34)13(6-27)20(31)14(7-28)24(19)35)36-25-16(9-30)21(32)15(8-29)22(33)18(12)25/h6-12,17,26,31-35H,5H2,1-4H3/t12-,17-,26-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H28O10/c1-10(2)5-12-17(11(3)4)26(19-23(34)13(6-27)20(31)14(7-28)24(19)35)36-25-16(9-30)21(32)15(8-29)22(33)18(12)25/h6-12,17,26,31-35H,5H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7404 |
| By standard InChI | CHEMBL453538 |
|---|---|
| By standard InChI Main Layer | CHEMBL453012 CHEMBL509880 CHEMBL453538 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eucalyptus albens | 183809 | Myrtaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05121 | Plasminogen activator inhibitor 1 | Secreted protein | CHEMBL453012 CHEMBL509880 CHEMBL453538 |
CHEMBL971918
(3)
|
1 / 2 |