| id | C00049886 |
|---|---|
| Name | Petrosaspongiolide N |
| CAS RN | 209408-72-0 |
| Standard InChI | InChI=1S/C29H42O8/c1-16(30)34-15-27(3)10-6-11-29(5)22(27)9-12-28(4)20-14-21(19-13-24(32)37-25(19)33)36-26(35-17(2)31)18(20)7-8-23(28)29/h13,18,20-23,25-26,33H,6-12,14-15H2,1-5H3/t18-,20+,21+,22-,23-,25?,26+,27+,28-,29-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H42O8/c1-16(30)34-15-27(3)10-6-11-29(5)22(27)9-12-28(4)20-14-21(19-13-24(32)37-25(19)33)36-26(35-17(2)31)18(20)7-8-23(28)29/h13,18,20-23,25-26,33H,6-12,14-15H2,1-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 691 |
| By standard InChI | CHEMBL499563 |
|---|---|
| By standard InChI Main Layer | CHEMBL499563 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thorectidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Petrosaspongia nigra | 1162789 | Thorectidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04054 | Phospholipase A2 | Enzyme | CHEMBL499563 |
CHEMBL1024191
(1)
CHEMBL1024192
(1)
|
0 / 0 |