| id | C00049887 |
|---|---|
| Name | Petrosaspongiolide P |
| CAS RN | 209408-74-2 |
| Standard InChI | InChI=1S/C25H38O5/c1-23(2)9-5-10-25(4)18(23)8-11-24(3)16-13-17(15-12-20(26)30-22(15)28)29-21(27)14(16)6-7-19(24)25/h12,14,16-19,21-22,27-28H,5-11,13H2,1-4H3/t14-,16+,17+,18-,19-,21+,22?,24-,25-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H38O5/c1-23(2)9-5-10-25(4)18(23)8-11-24(3)16-13-17(15-12-20(26)30-22(15)28)29-21(27)14(16)6-7-19(24)25/h12,14,16-19,21-22,27-28H,5-11,13H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 691 |
| By standard InChI | CHEMBL470340 |
|---|---|
| By standard InChI Main Layer | CHEMBL470340 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thorectidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Petrosaspongia nigra | 1162789 | Thorectidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04054 | Phospholipase A2 | Enzyme | CHEMBL470340 |
CHEMBL1024191
(1)
CHEMBL1024192
(1)
|
0 / 0 |