| id | C00049929 |
|---|---|
| Name | 1-Monomyristin |
| CAS RN | 589-68-4 |
| Standard InChI | InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h16,18-19H,2-15H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h16,18-19H,2-15H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 627 |
| By standard InChI | CHEMBL463092 |
|---|---|
| By standard InChI Main Layer | CHEMBL463092 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Arecaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Serenoa repens | 4722 | Arecaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL463092 |
CHEMBL2076221
(1)
|
1 / 0 |