id | C00005031 |
---|---|
Name | Uralenol / 2-[3,4-Dihydroxy-5-(3-methyl-2-butenyl)phenyl]-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
CAS RN | 139163-15-8 |
Standard InChI | InChI=1S/C20H18O7/c1-9(2)3-4-10-5-11(6-14(23)17(10)24)20-19(26)18(25)16-13(22)7-12(21)8-15(16)27-20/h3,5-8,21-24,26H,4H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C20H18O7/c1-9(2)3-4-10-5-11(6-14(23)17(10)24)20-19(26)18(25)16-13(22)7-12(21)8-15(16)27-20/h3,5-8,21-24,26H,4H2,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 15 |
By standard InChI | CHEMBL113833 |
---|---|
By standard InChI Main Layer | CHEMBL113833 |
By LinkDB |
---|
By CAS RN | C069533 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL113833 |
CHEMBL771170
(1)
|
0 / 0 |