| id | C00050342 |
|---|---|
| Name | Casearinone A |
| CAS RN | 196090-46-7 |
| Standard InChI | InChI=1S/C26H36O8/c1-8-14(2)9-10-25(7)15(3)11-22(30)26-20(12-19(13-21(25)26)31-16(4)27)23(32-17(5)28)34-24(26)33-18(6)29/h8-9,15,19-21,23-24H,1,10-13H2,2-7H3/b14-9+/t15-,19-,20+,21+,23+,24-,25-,26-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H36O8/c1-8-14(2)9-10-25(7)15(3)11-22(30)26-20(12-19(13-21(25)26)31-16(4)27)23(32-17(5)28)34-24(26)33-18(6)29/h8-9,15,19-21,23-24H,1,10-13H2,2-7H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3025 |
| By standard InChI | CHEMBL525043 |
|---|---|
| By standard InChI Main Layer | CHEMBL525043 CHEMBL459014 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Salicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Casearia guianensis | 681419 | Salicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P20701 | Integrin alpha-L | Membrane receptor | CHEMBL525043 CHEMBL459014 |
CHEMBL992906
(2)
|
0 / 0 |