| id | C00005159 |
|---|---|
| Name | Kaempferol 3-rhamnosyl-(1->2)-galactoside |
| CAS RN | 108906-96-3 |
| Standard InChI | InChI=1S/C27H30O15/c1-9-17(32)20(35)22(37)26(38-9)42-25-21(36)18(33)15(8-28)40-27(25)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3/t9?,15?,17-,18-,20?,21?,22-,25?,26-,27+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c1-9-17(32)20(35)22(37)26(38-9)42-25-21(36)18(33)15(8-28)40-27(25)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL507493 |
| By LinkDB |
|---|
| By CAS RN | C064704 |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Primulaceae | 2 |
| Amaranthaceae | 1 |
| Gentianaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Blackstonia perfoliata | 82736 | Gentianaceae | asterids | Viridiplantae |
| Chenopodium fremontii | 1072215 | Amaranthaceae | eudicotyledons | Viridiplantae |
| Lysimachia mauritiana | 306286 | Primulaceae | asterids | Viridiplantae |
| Lysimachia nummularia | 175113 | Primulaceae | asterids | Viridiplantae |