| id | C00000516 |
|---|---|
| Name | Ircinal A / (+)-Ircinal A |
| CAS RN | 139975-55-6 |
| Standard InChI | InChI=1S/C26H38N2O2/c29-19-21-17-26(30)13-8-4-1-2-5-9-14-27-16-12-23(21)25(20-27)18-22-11-7-3-6-10-15-28(22)24(25)26/h1,4,7,11,17,19,22-24,30H,2-3,5-6,8-10,12-16,18,20H2/b4-1-,11-7-/t22-,23-,24+,25-,26?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H38N2O2/c29-19-21-17-26(30)13-8-4-1-2-5-9-14-27-16-12-23(21)25(20-27)18-22-11-7-3-6-10-15-28(22)24(25)26/h1,4,7,11,17,19,22-24,30H,2-3,5-6,8-10,12-16,18,20H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2407 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL332054 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Niphatidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acanthostrongylophora sp. | ||||
| Amphimedon sp. | 178513 | Niphatidae | Metazoa | |
| Ircinia sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49841 | Glycogen synthase kinase-3 beta | Gsk | CHEMBL332054 |
CHEMBL966427
(1)
|
0 / 0 |