| id | C00005176 |
|---|---|
| Name | Lepidoside |
| CAS RN | 102733-90-4 |
| Standard InChI | InChI=1S/C26H28O14/c1-9-17(30)20(33)22(35)26(37-9)38-12-6-13(28)16-15(7-12)39-23(10-2-4-11(27)5-3-10)24(19(16)32)40-25-21(34)18(31)14(29)8-36-25/h2-7,9,14,17-18,20-22,25-31,33-35H,8H2,1H3/t9?,14-,17+,18?,20+,21?,22?,25+,26+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H28O14/c1-9-17(30)20(33)22(35)26(37-9)38-12-6-13(28)16-15(7-12)39-23(10-2-4-11(27)5-3-10)24(19(16)32)40-25-21(34)18(31)14(29)8-36-25/h2-7,9,14,17-18,20-22,25-31,33-35H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1929026 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Brassicaceae | 1 |
| Celastraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alysicarpus longifolius | 287749 | Fabaceae | rosids | Viridiplantae |
| Crotalaria semperflorens | 1127390 | Fabaceae | rosids | Viridiplantae |
| Lepidium perfoliatum | 153358 | Brassicaceae | rosids | Viridiplantae |
| Parnassia fimbriata | 3797 | Celastraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL1929026 |
CHEMBL1932251
(1)
CHEMBL1932253
(1)
|
0 / 0 |
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL1929026 |
CHEMBL1932254
(1)
CHEMBL1932258
(1)
CHEMBL1932265 (1) |
0 / 0 |