| id | C00005237 |
|---|---|
| Name | Kaempferol 3-neohesperidoside-7-rhamnoside / Kaempferol 3-O-alpha-rhamnopyranosyl-(1->2)-beta-glucopyranoside-7-O-alpha-rhamnopyranoside / 3-[[2-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-7-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 162062-89-7 |
| Standard InChI | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(46-10)48-14-7-15(36)18-16(8-14)49-28(12-3-5-13(35)6-4-12)29(22(18)40)51-33-30(25(43)21(39)17(9-34)50-33)52-32-27(45)24(42)20(38)11(2)47-32/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10?,11?,17?,19-,20-,21+,23-,24?,25?,26?,27-,30?,31-,32-,33-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(46-10)48-14-7-15(36)18-16(8-14)49-28(12-3-5-13(35)6-4-12)29(22(18)40)51-33-30(25(43)21(39)17(9-34)50-33)52-32-27(45)24(42)20(38)11(2)47-32/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 5 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1929027 CHEMBL1926685 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Crassulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sedum telephium | 91097 | Crassulaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL1929027 CHEMBL1926685 |
CHEMBL1932251
(2)
CHEMBL1932253
(2)
|
0 / 0 |
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL1929027 CHEMBL1926685 |
CHEMBL1932254
(2)
|
0 / 0 |