| id | C00005320 |
|---|---|
| Name | 6-Methoxykaempferol 4'-rhamnoside |
| CAS RN | 124962-14-7 |
| Standard InChI | InChI=1S/C22H22O11/c1-8-14(24)17(27)19(29)22(31-8)32-10-5-3-9(4-6-10)20-18(28)15(25)13-12(33-20)7-11(23)21(30-2)16(13)26/h3-8,14,17,19,22-24,26-29H,1-2H3/t8?,14-,17?,19-,22-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H22O11/c1-8-14(24)17(27)19(29)22(31-8)32-10-5-3-9(4-6-10)20-18(28)15(25)13-12(33-20)7-11(23)21(30-2)16(13)26/h3-8,14,17,19,22-24,26-29H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Crassulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Kalanchoe gracilis | 23012 | Crassulaceae | eudicotyledons | Viridiplantae |