| id | C00005371 | 
|---|---|
| Name | Quercetin 3-alloside | 
| CAS RN | 90327-16-5 | 
| Standard InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17?,18?,21+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 2 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL33027 CHEMBL309323 CHEMBL250450 CHEMBL251254 CHEMBL457304 CHEMBL1098724 CHEMBL2337335 CHEMBL2337336 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Euphyllophyta | 2 | 
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Thelypteridaceae | 2 | 
| Ranunculaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Glaucidium palmatum | 39106 | Ranunculaceae | eudicotyledons | Viridiplantae | 
| Thelypteris formosa | 29617 | Thelypteridaceae | Euphyllophyta | Viridiplantae | 
| Thelypteris nipponica | 746521 | Thelypteridaceae | Euphyllophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9NPH5 | NADPH oxidase 4 | Enzyme | CHEMBL1098724 | CHEMBL1249157
                        (1)
                        CHEMBL1249158
                        (1) CHEMBL1249160 (1) | 0 / 0 | 
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL33027 | CHEMBL1613842
                        (1) | 4 / 2 | 
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL251254 | CHEMBL1738312
                        (1) | 0 / 0 | 
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL250450 | CHEMBL1008559
                        (1)
                        CHEMBL1693776
                        (1) | 0 / 3 | 
| P06746 | DNA polymerase beta | Enzyme | CHEMBL250450 CHEMBL251254 | CHEMBL1614079
                        (2) | 0 / 0 | 
| P04062 | Glucosylceramidase | Enzyme | CHEMBL251254 | CHEMBL1613818
                        (1) | 6 / 4 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL33027 CHEMBL250450 CHEMBL251254 | CHEMBL1614175
                        (1)
                        CHEMBL1614076
                        (3) | 1 / 1 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL251254 | CHEMBL1614544
                        (1) | 11 / 10 | 
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL250450 | CHEMBL1014040
                        (2) | 1 / 1 | 
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL1098724 | CHEMBL1120976
                        (1) | 0 / 0 | 
| P07237 | Protein disulfide-isomerase | Enzyme | CHEMBL33027 | CHEMBL1964080
                        (1)
                        CHEMBL2114805
                        (1) | 0 / 0 | 
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL33027 CHEMBL250450 CHEMBL251254 | CHEMBL1614166
                        (3) | 1 / 0 | 
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL250450 | CHEMBL926465
                        (1) | 0 / 0 | 
| P36888 | Receptor-type tyrosine-protein kinase FLT3 | Pdgfr | CHEMBL250450 CHEMBL2337335 CHEMBL2337336 | CHEMBL2342404
                        (3) | 1 / 1 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL33027 | CHEMBL1794486
                        (1) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL33027 | CHEMBL2114780
                        (1) | 0 / 0 | 
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL250450 | CHEMBL926467
                        (1) | 0 / 0 | 
| P15121 | Aldose reductase | Enzyme | CHEMBL250450 | CHEMBL1942674
                        (2) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL33027 | CHEMBL1794569
                        (1) | 1 / 1 | 
| P09923 | Intestinal-type alkaline phosphatase | Enzyme | CHEMBL250450 | CHEMBL1738679
                        (1)
                        CHEMBL1738192
                        (1) | 0 / 0 | 
| P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | Enzyme | CHEMBL250450 | CHEMBL1738602
                        (1) | 3 / 1 | 
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL250450 | CHEMBL814345
                        (1) | 4 / 2 | 
| P06280 | Alpha-galactosidase A | Enzyme | CHEMBL251254 | CHEMBL1614217
                        (1) | 1 / 1 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL251254 | CHEMBL1614521
                        (1) | 0 / 0 | 
| P10696 | Alkaline phosphatase, placental-like | Enzyme | CHEMBL250450 | CHEMBL1738040
                        (1) | 0 / 1 | 
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL250450 | CHEMBL1687393
                        (1)
                        CHEMBL1687394
                        (1) | 2 / 0 | 
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL250450 | CHEMBL926466
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL33027 | CHEMBL1794483
                        (1) | 0 / 0 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL33027 CHEMBL250450 CHEMBL251254 | CHEMBL1614211
                        (3) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL250450 CHEMBL251254 | CHEMBL1614421
                        (2) | 4 / 3 | 
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL250450 | CHEMBL993916
                        (1) | 1 / 0 | 
| P34949 | Mannose-6-phosphate isomerase | Enzyme | CHEMBL33027 | CHEMBL1614255
                        (1) | 1 / 1 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL33027 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL33027 CHEMBL250450 CHEMBL251254 | CHEMBL1613914
                        (3) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL250450 CHEMBL251254 | CHEMBL1738442
                        (2) | 0 / 0 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL33027 | CHEMBL1613933
                        (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL33027 | CHEMBL1613933
                        (1) | 1 / 6 | 
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL33027 | CHEMBL2114738
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #103470 | Albinism, ocular, with sensorineural deafness | P14679 | 
| #203100 | Albinism, oculocutaneous, type ia; oca1a | P14679 | 
| #606952 | Albinism, oculocutaneous, type ib; oca1b | P14679 | 
| #614490 | Blood group, junior system; jr | Q9UNQ0 | 
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #602579 | Congenital disorder of glycosylation, type ib; cdg1b | P34949 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #301500 | Fabry disease | P06280 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #608013 | Gaucher disease, perinatal lethal | P04062 | 
| #230800 | Gaucher disease, type i | P04062 | 
| #230900 | Gaucher disease, type ii | P04062 | 
| #231000 | Gaucher disease, type iii | P04062 | 
| #231005 | Gaucher disease, type iiic | P04062 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #146300 | Hypophosphatasia, adult | P05186 | 
| #241510 | Hypophosphatasia, childhood | P05186 | 
| #241500 | Hypophosphatasia, infantile | P05186 | 
| #601626 | Leukemia, acute myeloid; aml | P36888 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #160900 | Myotonic dystrophy 1; dm1 | Q9NR56 | 
| #168600 | Parkinson disease, late-onset; pd | P04062 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #614674 | Periodic fever, menstrual cycle-dependent | P08908 | 
| #172700 | Pick disease of brain | P10636 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #601800 | Skin/hair/eye pigmentation, variation in, 3; shep3 | P14679 | 
| #253300 | Spinal muscular atrophy, type i; sma1 | Q16637 | 
| #253550 | Spinal muscular atrophy, type ii; sma2 | Q16637 | 
| #253400 | Spinal muscular atrophy, type iii; sma3 | Q16637 | 
| #271150 | Spinal muscular atrophy, type iv; sma4 | Q16637 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 | Q9UNQ0 | 
| #278300 | Xanthinuria, type i | P47989 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P04062
                            (related) | 
| H00126 | Gaucher disease | P04062
                            (related) | 
| H00426 | Defects in the degradation of ganglioside | P04062
                            (related) | 
| H00810 | Progressive myoclonic epilepsy (PME) | P04062
                            (related) | 
| H00213 | Hypophosphatasia | P05186
                            (related) | 
| H00125 | Fabry disease | P06280
                            (related) | 
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00023 | Testicular cancer | P10696
                            (marker) | 
| H00168 | Oculocutaneous albinism (OCA) | P14679
                            (related) | 
| H00038 | Malignant melanoma | P14679
                            (marker) | 
| H00118 | Congenital disorders of glycosylation (CDG) type I | P34949
                            (related) | 
| H00017 | Esophageal cancer | P35354
                            (related) | 
| H00025 | Penile cancer | P35354
                            (related) | 
| H00046 | Cholangiocarcinoma | P35354
                            (related) | 
| H00003 | Acute myeloid leukemia (AML) | P36888
                            (related) Q01196 (related) Q01196 (marker) Q13951 (marker) | 
| H00192 | Xanthinuria | P47989
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) | 
| H00455 | Spinal muscular atrophy (SMA) | Q16637
                            (related) Q16637 (related) | 
| H00403 | Disorders of nucleotide excision repair | Q9Y253
                            (related) |