| id | C00005375 | 
|---|---|
| Name | Quercetin 3-galacturonide | 
| CAS RN | 74336-89-3 | 
| Standard InChI | InChI=1S/C21H18O13/c22-7-4-10(25)12-11(5-7)32-17(6-1-2-8(23)9(24)3-6)18(13(12)26)33-21-16(29)14(27)15(28)19(34-21)20(30)31/h1-5,14-16,19,21-25,27-29H,(H,30,31)/t14?,15-,16?,19+,21-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C21H18O13/c22-7-4-10(25)12-11(5-7)32-17(6-1-2-8(23)9(24)3-6)18(13(12)26)33-21-16(29)14(27)15(28)19(34-21)20(30)31/h1-5,14-16,19,21-25,27-29H,(H,30,31) | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 2 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL520546 CHEMBL1506682 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Embryophyta | 1 | 
| family name | count | 
|---|---|
| Corsiniaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Corsinia coriandrina | 63791 | Corsiniaceae | Embryophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL1506682 | CHEMBL1738312
                        (1) | 0 / 0 | 
| P06746 | DNA polymerase beta | Enzyme | CHEMBL1506682 | CHEMBL1614079
                        (1) | 0 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL1506682 | CHEMBL1614076
                        (1) | 1 / 1 | 
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1506682 | CHEMBL1794585
                        (1) | 0 / 0 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1506682 | CHEMBL1614544
                        (1) | 11 / 10 | 
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL1506682 | CHEMBL1614166
                        (1) | 1 / 0 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1506682 | CHEMBL1614458
                        (1) | 0 / 0 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL1506682 | CHEMBL1794486
                        (1) | 0 / 0 | 
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1506682 | CHEMBL2114810
                        (1) | 7 / 3 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1506682 | CHEMBL1794569
                        (1) | 1 / 1 | 
| P09923 | Intestinal-type alkaline phosphatase | Enzyme | CHEMBL1506682 | CHEMBL1738087
                        (1)
                        CHEMBL1738192
                        (1) | 0 / 0 | 
| P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | Enzyme | CHEMBL1506682 | CHEMBL1738668
                        (1) | 3 / 1 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1506682 | CHEMBL1794401
                        (1) | 0 / 0 | 
| P10696 | Alkaline phosphatase, placental-like | Enzyme | CHEMBL1506682 | CHEMBL1738185
                        (1) | 0 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1506682 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL1506682 | CHEMBL1737991
                        (1) | 0 / 0 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1506682 | CHEMBL1614211
                        (1) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1506682 | CHEMBL1614421
                        (1) | 4 / 3 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1506682 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1506682 | CHEMBL1613914
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1506682 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1506682 | CHEMBL2114738
                        (1) | 0 / 0 | 
| Q14191 | Werner syndrome ATP-dependent helicase | Enzyme | CHEMBL1506682 | CHEMBL2114796
                        (1) | 2 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah | P63092 | 
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #114500 | Colorectal cancer; crc | Q14191 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #146300 | Hypophosphatasia, adult | P05186 | 
| #241510 | Hypophosphatasia, childhood | P05186 | 
| #241500 | Hypophosphatasia, infantile | P05186 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #174800 | Mccune-albright syndrome; mas | P63092 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #160900 | Myotonic dystrophy 1; dm1 | Q9NR56 | 
| #166350 | Osseous heteroplasia, progressive; poh | P63092 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #102200 | Pituitary adenoma, growth hormone-secreting | P63092 | 
| #103580 | Pseudohypoparathyroidism, type ia; php1a | P63092 | 
| #603233 | Pseudohypoparathyroidism, type ib; php1b | P63092 | 
| #612462 | Pseudohypoparathyroidism, type ic; php1c | P63092 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| #277700 | Werner syndrome; wrn | Q14191 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00213 | Hypophosphatasia | P05186
                            (related) | 
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00023 | Testicular cancer | P10696
                            (marker) | 
| H00244 | Pseudohypoparathyroidism | P63092
                            (related) | 
| H00441 | Progressive osseous heteroplasia (POH) | P63092
                            (related) | 
| H00501 | Fibrous dysplasia, polyostotic | P63092
                            (related) | 
| H00296 | Defects in RecQ helicases | Q14191
                            (related) | 
| H00403 | Disorders of nucleotide excision repair | Q9Y253
                            (related) |