| id | C00000617 |
|---|---|
| Name | Egonol 2-methylbutanoate |
| CAS RN | 115334-06-0 |
| Standard InChI | InChI=1S/C24H26O6/c1-4-15(2)24(25)27-9-5-6-16-10-18-13-20(30-23(18)22(11-16)26-3)17-7-8-19-21(12-17)29-14-28-19/h7-8,10-13,15H,4-6,9,14H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C24H26O6/c1-4-15(2)24(25)27-9-5-6-16-10-18-13-20(30-23(18)22(11-16)26-3)17-7-8-19-21(12-17)29-14-28-19/h7-8,10-13,15H,4-6,9,14H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3294 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1834810 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 1 |
| family name | count |
|---|---|
| Aneuraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Riccardia multifida subsp. Decrescens | 39025 | Aneuraceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL1834810 |
CHEMBL1840095
(1)
CHEMBL1840096
(1)
CHEMBL1840097 (1) |
1 / 0 |