| id | C00006215 |
|---|---|
| Name | Vitexin 7-O-glucoside |
| CAS RN | 35109-95-6 |
| Standard InChI | InChI=1S/C27H30O15/c28-7-15-19(33)21(35)23(37)26(40-15)18-14(41-27-24(38)22(36)20(34)16(8-29)42-27)6-12(32)17-11(31)5-13(39-25(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-24,26-30,32-38H,7-8H2/t15?,16?,19-,20-,21+,22+,23?,24?,26+,27-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c28-7-15-19(33)21(35)23(37)26(40-15)18-14(41-27-24(38)22(36)20(34)16(8-29)42-27)6-12(32)17-11(31)5-13(39-25(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-24,26-30,32-38H,7-8H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| Liliopsida | 1 |
| eudicotyledons | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| Orchidaceae | 1 |
| Molluginaceae | 1 |
| Fabaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Achillea fragrantissima | 282738 | Asteraceae | asterids | Viridiplantae |
| Cymbidium spp. | 14366 | Orchidaceae | Liliopsida | Viridiplantae |
| Mollugo oppositifolia | 3591 | Molluginaceae | eudicotyledons | Viridiplantae |
| Trigonella foenum-graecum | 78534 | Fabaceae | rosids | Viridiplantae |