| id | C00006217 |
|---|---|
| Name | Vitexin 2''-O-rhamnoside |
| CAS RN | 64820-99-1 |
| Standard InChI | InChI=1S/C27H30O14/c1-9-19(33)21(35)23(37)27(38-9)41-26-22(36)20(34)16(8-28)40-25(26)18-13(31)6-12(30)17-14(32)7-15(39-24(17)18)10-2-4-11(29)5-3-10/h2-7,9,16,19-23,25-31,33-37H,8H2,1H3/t9?,16?,19-,20+,21-,22-,23?,25-,26?,27-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O14/c1-9-19(33)21(35)23(37)27(38-9)41-26-22(36)20(34)16(8-28)40-25(26)18-13(31)6-12(30)17-14(32)7-15(39-24(17)18)10-2-4-11(29)5-3-10/h2-7,9,16,19-23,25-31,33-37H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1685070 |
| By LinkDB | C12628 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 3 |
| rosids | 3 |
| Spermatophyta | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Poaceae | 2 |
| Fabaceae | 2 |
| Podocarpaceae | 1 |
| Rutaceae | 1 |
| Asparagaceae | 1 |
| Gentianaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL1685070 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|