id | C00006414 |
---|---|
Name | Swertifrancheside |
CAS RN | 155740-03-7 |
Standard InChI | InChI=1S/C35H28O17/c1-49-11-5-15(39)22-19(6-11)51-33-17(41)7-12(26(42)24(33)29(22)45)21-28(44)25(35-32(48)31(47)27(43)20(9-36)52-35)30(46)23-16(40)8-18(50-34(21)23)10-2-3-13(37)14(38)4-10/h2-8,20,27,31-32,35-39,41-44,46-48H,9H2,1H3/t20?,27-,31+,32?,35+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C35H28O17/c1-49-11-5-15(39)22-19(6-11)51-33-17(41)7-12(26(42)24(33)29(22)45)21-28(44)25(35-32(48)31(47)27(43)20(9-36)52-35)30(46)23-16(40)8-18(50-34(21)23)10-2-3-13(37)14(38)4-10/h2-8,20,27,31-32,35-39,41-44,46-48H,9H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3836 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL504840 |
By LinkDB |
---|
By CAS RN | C087101 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Gentianaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Swertia franchetiana | 50785 | Gentianaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P06746 | DNA polymerase beta | Enzyme | CHEMBL504840 |
CHEMBL1026664
(1)
|
0 / 0 |