| id | C00006508 |
|---|---|
| Name | 2,3-Dihydroamentoflavone |
| CAS RN | 34340-51-7 |
| Standard InChI | InChI=1S/C30H20O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-10,12,25,31-36H,11H2 |
| Standard InChI (Main Layer) | InChI=1S/C30H20O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-10,12,25,31-36H,11H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 88 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL220741 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 3 |
| family name | count |
|---|---|
| Cupressaceae | 2 |
| Cycadaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cycas revoluta | 3396 | Cycadaceae | Spermatophyta | Viridiplantae |
| Libocedrus bidwillii | 103974 | Cupressaceae | Spermatophyta | Viridiplantae |
| Libocedrus plumosa | 13595 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43235 | Cathepsin K | C1A | CHEMBL220741 |
CHEMBL913665
(1)
|
1 / 2 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL220741 |
CHEMBL1211753
(1)
|
0 / 0 |