| id | C00006590 |
|---|---|
| Name | Strictatriluteolin |
| CAS RN | 171784-02-4 |
| Standard InChI | InChI=1S/C45H26O18/c46-16-8-23(51)37-26(54)12-31(62-33(37)9-16)17-2-5-21(49)43(59)36(17)41-25(53)10-24(52)38-27(55)13-32(63-45(38)41)18-3-6-20(48)42(58)35(18)40-29(57)14-34-39(44(40)60)28(56)11-30(61-34)15-1-4-19(47)22(50)7-15/h1-14,46-53,57-60H |
| Standard InChI (Main Layer) | InChI=1S/C45H26O18/c46-16-8-23(51)37-26(54)12-31(62-33(37)9-16)17-2-5-21(49)43(59)36(17)41-25(53)10-24(52)38-27(55)13-32(63-45(38)41)18-3-6-20(48)42(58)35(18)40-29(57)14-34-39(44(40)60)28(56)11-30(61-34)15-1-4-19(47)22(50)7-15/h1-14,46-53,57-60H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1166 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 2 |
| family name | count |
|---|---|
| Bartramiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bartramia pomiformis | 52976 | Bartramiaceae | Embryophyta | Viridiplantae |
| Bartramia stricta | 66990 | Bartramiaceae | Embryophyta | Viridiplantae |