| id | C00006815 |
|---|---|
| Name | Cyanidin 3-(6''-malonylglucoside)-5-glucoside |
| CAS RN | 104055-86-9 |
| Standard InChI | InChI=1S/C30H32O19/c31-8-18-22(38)24(40)26(42)29(48-18)46-16-5-11(32)4-15-12(16)6-17(28(45-15)10-1-2-13(33)14(34)3-10)47-30-27(43)25(41)23(39)19(49-30)9-44-21(37)7-20(35)36/h1-6,18-19,22-27,29-31,38-43H,7-9H2,(H3-,32,33,34,35,36)/p+1/t18?,19?,22-,23-,24+,25?,26?,27?,29-,30-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H32O19/c31-8-18-22(38)24(40)26(42)29(48-18)46-16-5-11(32)4-15-12(16)6-17(28(45-15)10-1-2-13(33)14(34)3-10)47-30-27(43)25(41)23(39)19(49-30)9-44-21(37)7-20(35)36/h1-6,18-19,22-27,29-31,38-43H,7-9H2,(H3-,32,33,34,35,36) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 6 |
| family name | count |
|---|---|
| Lamiaceae | 5 |
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dahlia variabilis | 101596 | Asteraceae | asterids | Viridiplantae |
| Glechoma hederacea | 28509 | Lamiaceae | asterids | Viridiplantae |
| Thymus doerfleri | 49990 | Lamiaceae | asterids | Viridiplantae |
| Thymus pannonicus | 49990 | Lamiaceae | asterids | Viridiplantae |
| Thymus praecox | 347388 | Lamiaceae | asterids | Viridiplantae |
| Thymus serphyllum | 49990 | Lamiaceae | asterids | Viridiplantae |