| id | C00000703 |
|---|---|
| Name | Enterolactone |
| CAS RN | 78473-71-9 |
| Standard InChI | InChI=1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3222 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL471475 CHEMBL465152 |
| By LinkDB | C18165 |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04278 | Sex hormone-binding globulin | Secreted protein | CHEMBL465152 |
CHEMBL1025921
(1)
|
0 / 0 |