| id | C00007123 |
|---|---|
| Name | 4'-O-Geranylisoliquiritigenin / 4'-Geranyloxy-4,2'-dihydroxychalcone |
| CAS RN | 130289-23-5 |
| Standard InChI | InChI=1S/C25H28O4/c1-18(2)5-4-6-19(3)15-16-29-22-12-13-23(25(28)17-22)24(27)14-9-20-7-10-21(26)11-8-20/h5,7-15,17,26,28H,4,6,16H2,1-3H3/b14-9+,19-15+ |
| Standard InChI (Main Layer) | InChI=1S/C25H28O4/c1-18(2)5-4-6-19(3)15-16-29-22-12-13-23(25(28)17-22)24(27)14-9-20-7-10-21(26)11-8-20/h5,7-15,17,26,28H,4,6,16H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3649 |
| By standard InChI | CHEMBL567921 |
|---|---|
| By standard InChI Main Layer | CHEMBL567921 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Millettia ferruginea | 53625 | Fabaceae | rosids | Viridiplantae |
| Millettia griffoniana | 53625 | Fabaceae | rosids | Viridiplantae |
| Millettia usaramensis subsp. usaramensis | 53625 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL567921 |
CHEMBL2025894
(1)
CHEMBL2025895
(1)
CHEMBL2025896 (1) CHEMBL2025897 (1) CHEMBL2025898 (1) CHEMBL2025899 (1) CHEMBL2025900 (1) CHEMBL2025901 (1) |
0 / 0 |