| id | C00007168 |
|---|---|
| Name | Methylliderone |
| CAS RN | 3984-73-4 |
| Standard InChI | InChI=1S/C17H16O5/c1-20-12(10-9-11-7-5-4-6-8-11)13-14(18)16(21-2)17(22-3)15(13)19/h4-10H,1-3H3/b10-9+ |
| Standard InChI (Main Layer) | InChI=1S/C17H16O5/c1-20-12(10-9-11-7-5-4-6-8-11)13-14(18)16(21-2)17(22-3)15(13)19/h4-10H,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2661 |
| By standard InChI | CHEMBL44725 |
|---|---|
| By standard InChI Main Layer | CHEMBL44725 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 3 |
| family name | count |
|---|---|
| Lauraceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lindera erythrocarpa | 128639 | Lauraceae | Magnoliophyta | Viridiplantae |
| Lindera lucida | 384295 | Lauraceae | Magnoliophyta | Viridiplantae |
| Lindera pipericarpa | 3433 | Lauraceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23946 | Chymase | S1A | CHEMBL44725 |
CHEMBL806255
(1)
|
0 / 0 |