id | C00007222 |
---|---|
Name | Xanthosine |
CAS RN | 146-80-5 |
Standard InChI | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3?,5?,6?,9-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19) |
Phytochemical cluster | No. 12 |
---|---|
KCF-S cluster | No. 3939 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL402439 CHEMBL1880013 |
By LinkDB | C01762 |
---|
By CAS RN | C005893 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Rubiaceae | 1 |
Enterobacteriaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Coffea arabica | 13443 | Rubiaceae | asterids | Viridiplantae |
Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1880013 |
CHEMBL2354282
(1)
|
4 / 2 |
P39748 | Flap endonuclease 1 | Enzyme | CHEMBL1880013 |
CHEMBL1794486
(1)
|
0 / 0 |