| id | C00007232 |
|---|---|
| Name | Pelargonidin |
| CAS RN | 134-04-3 |
| Standard InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-7H,(H3-,16,17,18,19)/p+1 |
| Standard InChI (Main Layer) | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-7H,(H3-,16,17,18,19) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL1197905 |
|---|---|
| By standard InChI Main Layer | CHEMBL1197905 |
| By LinkDB | C05904 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28907 | ADP-ribosyl cyclase 1 | Enzyme | CHEMBL1197905 |
CHEMBL1799589
(1)
|
0 / 1 |