| id | C00007310 |
|---|---|
| Name | Caffeyl alcohol |
| CAS RN | |
| Standard InChI | InChI=1S/C9H10O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-4,6,10-12H,5H2/b2-1+ |
| Standard InChI (Main Layer) | InChI=1S/C9H10O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-4,6,10-12H,5H2 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 3417 |
| By standard InChI | CHEMBL1321891 |
|---|---|
| By standard InChI Main Layer | CHEMBL1321891 |
| By LinkDB | C12206 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1321891 |
CHEMBL1614458
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1321891 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL1321891 |
CHEMBL1613829
(1)
|
0 / 0 |