id | C00007324 |
---|---|
Name | Isopentenyladenosine / Isopentenyladenine riboside |
CAS RN | 7724-76-7 |
Standard InChI | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18)/t9-,11?,12+,15-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 989 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL452867 CHEMBL610981 CHEMBL1163921 |
By LinkDB | C16427 |
---|
By CAS RN | D007541 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Brassicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P04406 | Glyceraldehyde-3-phosphate dehydrogenase | Enzyme | CHEMBL610981 |
CHEMBL681383
(1)
CHEMBL684050
(1)
CHEMBL684051 (1) |
0 / 0 |
P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL452867 |
CHEMBL965574
(1)
|
1 / 1 |