id | C00007326 |
---|---|
Name | 7-Methylxanthine |
CAS RN | 552-62-5 |
Standard InChI | InChI=1S/C6H6N4O2/c1-10-2-7-4-3(10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12) |
Standard InChI (Main Layer) | InChI=1S/C6H6N4O2/c1-10-2-7-4-3(10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12) |
Phytochemical cluster | No. 12 |
---|---|
KCF-S cluster | No. 2266 |
By standard InChI | CHEMBL321248 |
---|---|
By standard InChI Main Layer | CHEMBL321248 |
By LinkDB | C16353 |
---|
By CAS RN | C064273 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Coffea arabica | 13443 | Rubiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9Y2T3 | Guanine deaminase | Enzyme | CHEMBL321248 |
CHEMBL1225632
(1)
CHEMBL1225633
(1)
|
0 / 0 |