id | C00007412 |
---|---|
Name | Erythrose |
CAS RN | 1758-51-6 |
Standard InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7293 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL25834 |
By LinkDB |
---|
By CAS RN | C073321 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Brassicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10323 | Acrosin | S1A | CHEMBL25834 |
CHEMBL639054
(1)
|
0 / 0 |