| id | C00007412 |
|---|---|
| Name | Erythrose |
| CAS RN | 1758-51-6 |
| Standard InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7293 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL25834 |
| By LinkDB |
|---|
| By CAS RN | C073321 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10323 | Acrosin | S1A | CHEMBL25834 |
CHEMBL639054
(1)
|
0 / 0 |