id | C00000748 |
---|---|
Name | Sparsomycin |
CAS RN | 1404-64-4 |
Standard InChI | InChI=1S/C13H19N3O5S2/c1-8-10(12(19)16-13(20)14-8)3-4-11(18)15-9(5-17)6-23(21)7-22-2/h3-4,9,17H,5-7H2,1-2H3,(H,15,18)(H2,14,16,19,20)/b4-3+/t9-,23?/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C13H19N3O5S2/c1-8-10(12(19)16-13(20)14-8)3-4-11(18)15-9(5-17)6-23(21)7-22-2/h3-4,9,17H,5-7H2,1-2H3,(H,15,18)(H2,14,16,19,20) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 8859 |
By standard InChI | CHEMBL38707 |
---|---|
By standard InChI Main Layer | CHEMBL38707 CHEMBL101960 CHEMBL105720 CHEMBL318979 CHEMBL320837 CHEMBL2303630 |
By LinkDB |
---|
By CAS RN | D013033 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces cuspidosporus | 66882 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P68104 | Elongation factor 1-alpha 1 | Unclassified protein | CHEMBL2303630 |
CHEMBL1228365
(1)
|
0 / 0 |