id | C00000751 |
---|---|
Name | Phenylpyruvic acid |
CAS RN | 156-06-9 |
Standard InChI | InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
Standard InChI (Main Layer) | InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5246 |
By standard InChI | CHEMBL1162488 |
---|---|
By standard InChI Main Layer | CHEMBL1162488 |
By LinkDB | C00166 |
---|
By CAS RN | C031606 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Enterobacteriaceae | 1 |
Brassicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
Escherichia coli | 562 | Enterobacteriaceae | Bacteria | |
Pseudomonas sp. | 306 | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL1162488 |
CHEMBL2076227
(1)
|
0 / 0 |