| id | C00007511 |
|---|---|
| Name | Caffeic aldehyde / 3,4-Dihydroxycinnamaldehyde |
| CAS RN | 68149-78-0 |
| Standard InChI | InChI=1S/C9H8O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-6,11-12H/b2-1+ |
| Standard InChI (Main Layer) | InChI=1S/C9H8O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-6,11-12H |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 3417 |
| By standard InChI | CHEMBL17291 |
|---|---|
| By standard InChI Main Layer | CHEMBL17291 |
| By LinkDB | C10945 |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Petasites tricholobus | 186966 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL17291 |
CHEMBL1014040
(1)
|
1 / 1 |