| id | C00007556 |
|---|---|
| Name | Dihydrozeatin riboside |
| CAS RN | |
| Standard InChI | InChI=1S/C15H23N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h6-9,11-12,15,21-24H,2-5H2,1H3,(H,16,17,18)/t8?,9-,11+,12?,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H23N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h6-9,11-12,15,21-24H,2-5H2,1H3,(H,16,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 989 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL608173 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04406 | Glyceraldehyde-3-phosphate dehydrogenase | Enzyme | CHEMBL608173 |
CHEMBL681383
(1)
|
0 / 0 |