| id | C00007595 |
|---|---|
| Name | meso-2,6-Diaminopimelate / meso-2,6-Diaminoheptanedioate |
| CAS RN | |
| Standard InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+ |
| Standard InChI (Main Layer) | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2039 |
| By standard InChI | CHEMBL415306 |
|---|---|
| By standard InChI Main Layer | CHEMBL415306 |
| By LinkDB | C00680 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |