| id | C00007598 |
|---|---|
| Name | N-Succinyl-2-L-amino-6-oxopimelate / N-Succinyl-2-L-amino-6-ketopimelate |
| CAS RN | |
| Standard InChI | InChI=1S/C11H15NO8/c13-7(11(19)20)3-1-2-6(10(17)18)12-8(14)4-5-9(15)16/h6H,1-5H2,(H,12,14)(H,15,16)(H,17,18)(H,19,20)/t6-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H15NO8/c13-7(11(19)20)3-1-2-6(10(17)18)12-8(14)4-5-9(15)16/h6H,1-5H2,(H,12,14)(H,15,16)(H,17,18)(H,19,20) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3296 |
| By standard InChI | CHEMBL175209 |
|---|---|
| By standard InChI Main Layer | CHEMBL175209 |
| By LinkDB | C04462 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O15228 | Dihydroxyacetone phosphate acyltransferase | Enzyme | CHEMBL175209 |
CHEMBL665114
(1)
|
1 / 1 |