| id | C00007881 |
|---|---|
| Name | Isosalipurposide |
| CAS RN | 4547-85-7 |
| Standard InChI | InChI=1S/C21H22O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-8,16,18-24,26-29H,9H2/b6-3+/t16?,18-,19+,20?,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-8,16,18-24,26-29H,9H2 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 36 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2029165 |
| By LinkDB | C16406 |
|---|
| By CAS RN | C027321 |
|---|
| class name | count |
|---|---|
| asterids | 8 |
| rosids | 7 |
| eudicotyledons | 2 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 4 |
| Salicaceae | 3 |
| Acanthaceae | 2 |
| Fabaceae | 2 |
| Gesneriaceae | 2 |
| Rosaceae | 1 |
| Paeoniaceae | 1 |
| Caryophyllaceae | 1 |
| Onagraceae | 1 |
| Nymphaeaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL2029165 |
CHEMBL809058
(1)
|
1 / 1 |