| id | C00008033 |
|---|---|
| Name | Antiarone A |
| CAS RN | 128883-66-9 |
| Standard InChI | InChI=1S/C25H26O6/c1-13(2)5-8-16-15(7-10-18(26)23(16)28)11-21-25(30)22-20(31-21)12-19(27)17(24(22)29)9-6-14(3)4/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H26O6/c1-13(2)5-8-16-15(7-10-18(26)23(16)28)11-21-25(30)22-20(31-21)12-19(27)17(24(22)29)9-6-14(3)4/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4425 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Antiaris toxicaria | 241857 | Moraceae | rosids | Viridiplantae |