| id | C00008069 |
|---|---|
| Name | 2,6,3'-Trihydroxy-4'-methoxy-2-benzylcoumaranone |
| CAS RN | 93012-79-4 |
| Standard InChI | InChI=1S/C16H14O6/c1-21-13-5-2-9(6-12(13)18)8-16(20)15(19)11-4-3-10(17)7-14(11)22-16/h2-7,17-18,20H,8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O6/c1-21-13-5-2-9(6-12(13)18)8-16(20)15(19)11-4-3-10(17)7-14(11)22-16/h2-7,17-18,20H,8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1085 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Anacardiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Schinopsis balansae | 263468 | Anacardiaceae | rosids | Viridiplantae |
| Schinopsis lorentzii | 289763 | Anacardiaceae | rosids | Viridiplantae |