| id | C00008214 |
|---|---|
| Name | Naringenin 5,7-di-O-glucoside |
| CAS RN | 5180-65-4 |
| Standard InChI | InChI=1S/C27H32O15/c28-8-17-20(32)22(34)24(36)26(41-17)38-12-5-15-19(13(31)7-14(39-15)10-1-3-11(30)4-2-10)16(6-12)40-27-25(37)23(35)21(33)18(9-29)42-27/h1-6,14,17-18,20-30,32-37H,7-9H2/t14?,17?,18?,20-,21-,22+,23+,24?,25?,26-,27-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H32O15/c28-8-17-20(32)22(34)24(36)26(41-17)38-12-5-15-19(13(31)7-14(39-15)10-1-3-11(30)4-2-10)16(6-12)40-27-25(37)23(35)21(33)18(9-29)42-27/h1-6,14,17-18,20-30,32-37H,7-9H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 48 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1726439 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Crataegus phaenopyrum | 416292 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1726439 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1726439 |
CHEMBL1738588
(1)
|
0 / 0 |