| id | C00008659 |
|---|---|
| Name | Gericudranin C |
| CAS RN | 172617-93-5 |
| Standard InChI | InChI=1S/C22H18O8/c23-12-4-1-10(2-5-12)7-13-15(25)9-17-18(19(13)27)20(28)21(29)22(30-17)11-3-6-14(24)16(26)8-11/h1-6,8-9,21-27,29H,7H2/t21-,22+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H18O8/c23-12-4-1-10(2-5-12)7-13-15(25)9-17-18(19(13)27)20(28)21(29)22(30-17)11-3-6-14(24)16(26)8-11/h1-6,8-9,21-27,29H,7H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1068 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Maclura tricuspidata | 210328 | Moraceae | rosids | Viridiplantae |