| id | C00008806 |
|---|---|
| Name | ent-Epiafzelechin |
| CAS RN | 36801-69-1 |
| Standard InChI | InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2/t13-,15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 52 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL159303 CHEMBL1326092 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cassia fistula | 53852 | Fabaceae | rosids | Viridiplantae |
| Livistona chinensis | 115492 | Arecaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL159303 |
CHEMBL1020816
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL159303 |
CHEMBL1020815
(1)
CHEMBL1008496
(1)
|
0 / 0 |
| Q9UM73 | ALK tyrosine kinase receptor | TKL serine/threonine protein kinase STKR type 1 subfamily | CHEMBL1326092 |
CHEMBL1781229
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1326092 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1326092 |
CHEMBL1794536
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL1326092 |
CHEMBL1614257
(1)
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1326092 |
CHEMBL1614257
(1)
CHEMBL1614531
(1)
|
1 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #613014 | Neuroblastoma, susceptibility to, 3; nblst3 |
Q9UM73
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00017 | Esophageal cancer |
P35354
(related)
|
| H00025 | Penile cancer |
P35354
(related)
|
| H00046 | Cholangiocarcinoma |
P35354
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00014 | Non-small cell lung cancer |
Q9UM73
(related)
|