| id | C00008820 |
|---|---|
| Name | Ourateacatechin / (-)-4'-Methylepigallocatechin |
| CAS RN | 17291-05-3 |
| Standard InChI | InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3/t13-,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 52 |
| By standard InChI | CHEMBL485460 |
|---|---|
| By standard InChI Main Layer | CHEMBL485460 CHEMBL465620 CHEMBL1651274 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 7 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Celastraceae | 6 |
| Erythropalaceae | 1 |
| Ochnaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL485460 CHEMBL465620 |
CHEMBL1008562
(1)
CHEMBL1008563
(1)
|
0 / 3 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL485460 |
CHEMBL1664298
(1)
|
0 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL485460 CHEMBL465620 |
CHEMBL1008496
(2)
|
0 / 0 |