| id | C00008821 | 
|---|---|
| Name | ent-Gallocatechin 4'-methyl ether | 
| CAS RN | 139687-23-3 | 
| Standard InChI | InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3/t13-,15+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3 | 
| Phytochemical cluster | No. 14 | 
|---|---|
| KCF-S cluster | No. 52 | 
| By standard InChI | CHEMBL465620 | 
|---|---|
| By standard InChI Main Layer | CHEMBL485460 CHEMBL465620 CHEMBL1651274 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Cassia trachypus | 53851 | Fabaceae | rosids | Viridiplantae | 
| Panda oleosa | 212258 | Pandaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL485460 CHEMBL465620 | CHEMBL1008562
                        (1)
                        CHEMBL1008563
                        (1) | 0 / 3 | 
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL485460 | CHEMBL1664298
                        (1) | 0 / 0 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL485460 CHEMBL465620 | CHEMBL1008496
                        (2) | 0 / 0 |